C10H8N4O — CID 116865160
4-amino-2-(5-methylfuran-2-yl)pyrimidine-5-carbonitrile (PubChem CID 116865160) has the molecular formula C10H8N4O and a molecular weight of 200.20 g/mol. Its IUPAC name is 4-amino-2-(5-methylfuran-2-yl)pyrimidine-5-carbonitrile.
| Compound Name | 4-amino-2-(5-methylfuran-2-yl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 116865160 |
| Molecular Formula | C10H8N4O |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 4-amino-2-(5-methylfuran-2-yl)pyrimidine-5-carbonitrile |
| SMILES | Cc1ccc(-c2ncc(C#N)c(N)n2)o1 |
| InChI | InChI=1S/C10H8N4O/c1-6-2-3-8(15-6)10-13-5-7(4-11)9(12)14-10/h2-3,5H,1H3,(H2,12,13,14) |
| InChIKey | HDXZVTUFAVIGRR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |