About 1-[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile
1-[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile (PubChem CID 116865556) has the molecular formula C12H11N3S
and a molecular weight of 229.31 g/mol. Its IUPAC name is 1-[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile.
Molecular Properties
| Compound Name | 1-[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile |
| PubChem CID | 116865556 |
| Molecular Formula | C12H11N3S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 1-[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile |
| SMILES | N#CC1(c2nc(-c3cc[nH]c3)cs2)CCC1 |
| InChI | InChI=1S/C12H11N3S/c13-8-12(3-1-4-12)11-15-10(7-16-11)9-2-5-14-6-9/h2,5-7,14H,1,3-4H2 |
| InChIKey | QJPAKFQBMMFQAP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile?
The IUPAC name of 1-[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile (CID 116865556) is 1-[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile.
What is the SMILES notation for 1-[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile?
The canonical SMILES for 1-[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile is N#CC1(c2nc(-c3cc[nH]c3)cs2)CCC1.
What is the InChIKey of 1-[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile?
The InChIKey is QJPAKFQBMMFQAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3S/c13-8-12(3-1-4-12)11-15-10(7-16-11)9-2-5-14-6-9/h2,5-7,14H,1,3-4H2.
What are the key properties of 1-[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile?
1-[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile has a molecular weight of 229.31 g/mol, XLogP of 3.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile is sourced from PubChem (CID 116865556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).