About 1-[4-(2-bromophenyl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile
1-[4-(2-bromophenyl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile (PubChem CID 116865572) has the molecular formula C14H11BrN2S
and a molecular weight of 319.23 g/mol. Its IUPAC name is 1-[4-(2-bromophenyl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile.
Molecular Properties
| Compound Name | 1-[4-(2-bromophenyl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile |
| PubChem CID | 116865572 |
| Molecular Formula | C14H11BrN2S |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | 1-[4-(2-bromophenyl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile |
| SMILES | N#CC1(c2nc(-c3ccccc3Br)cs2)CCC1 |
| InChI | InChI=1S/C14H11BrN2S/c15-11-5-2-1-4-10(11)12-8-18-13(17-12)14(9-16)6-3-7-14/h1-2,4-5,8H,3,6-7H2 |
| InChIKey | VRSSGDWMIWPFLQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-(2-bromophenyl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2-bromophenyl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile?
The IUPAC name of 1-[4-(2-bromophenyl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile (CID 116865572) is 1-[4-(2-bromophenyl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile.
What is the SMILES notation for 1-[4-(2-bromophenyl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile?
The canonical SMILES for 1-[4-(2-bromophenyl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile is N#CC1(c2nc(-c3ccccc3Br)cs2)CCC1.
What is the InChIKey of 1-[4-(2-bromophenyl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile?
The InChIKey is VRSSGDWMIWPFLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BrN2S/c15-11-5-2-1-4-10(11)12-8-18-13(17-12)14(9-16)6-3-7-14/h1-2,4-5,8H,3,6-7H2.
What are the key properties of 1-[4-(2-bromophenyl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile?
1-[4-(2-bromophenyl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile has a molecular weight of 319.23 g/mol, XLogP of 4.52, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2-bromophenyl)-1,3-thiazol-2-yl]cyclobutane-1-carbonitrile is sourced from PubChem (CID 116865572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).