C14H14FNOS — CID 116865623
[1-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]cyclobutyl]methanol (PubChem CID 116865623) has the molecular formula C14H14FNOS and a molecular weight of 263.34 g/mol. Its IUPAC name is [1-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]cyclobutyl]methanol.
| Compound Name | [1-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]cyclobutyl]methanol |
|---|---|
| PubChem CID | 116865623 |
| Molecular Formula | C14H14FNOS |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | [1-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]cyclobutyl]methanol |
| SMILES | OCC1(c2nc(-c3ccccc3F)cs2)CCC1 |
| InChI | InChI=1S/C14H14FNOS/c15-11-5-2-1-4-10(11)12-8-18-13(16-12)14(9-17)6-3-7-14/h1-2,4-5,8,17H,3,6-7,9H2 |
| InChIKey | LNWWRWRFXWAAEO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |