2-(2,4-difluorophenyl)-2-methylpropane-1-sulfonyl chloride

C10H11ClF2O2S — CID 116866432

IUPAC2-(2,4-difluorophenyl)-2-methylpropane-1-sulfonyl chloride
SMILESCC(C)(CS(=O)(=O)Cl)c1ccc(F)cc1F
InChIInChI=1S/C10H11ClF2O2S/c1-10(2,6-16(11,14)15)8-4-3-7(12)5-9(8)13/h3-5H,6H2,1-2H3
InChIKeyCAORMGUYQVSQAB-UHFFFAOYSA-N
MW268.71 g/mol
LogP2.81
Rot. Bonds3

About 2-(2,4-difluorophenyl)-2-methylpropane-1-sulfonyl chloride

2-(2,4-difluorophenyl)-2-methylpropane-1-sulfonyl chloride (PubChem CID 116866432) has the molecular formula C10H11ClF2O2S and a molecular weight of 268.71 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-2-methylpropane-1-sulfonyl chloride.

Molecular Properties

Compound Name2-(2,4-difluorophenyl)-2-methylpropane-1-sulfonyl chloride
PubChem CID116866432
Molecular FormulaC10H11ClF2O2S
Molecular Weight268.71 g/mol
Exact Mass268.01
IUPAC Name2-(2,4-difluorophenyl)-2-methylpropane-1-sulfonyl chloride
SMILESCC(C)(CS(=O)(=O)Cl)c1ccc(F)cc1F
InChIInChI=1S/C10H11ClF2O2S/c1-10(2,6-16(11,14)15)8-4-3-7(12)5-9(8)13/h3-5H,6H2,1-2H3
InChIKeyCAORMGUYQVSQAB-UHFFFAOYSA-N
XLogP2.81
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.71
LogP ≤ 52.81
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 2-(2,4-difluorophenyl)-2-methylpropane-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,4-difluorophenyl)-2-methylpropane-1-sulfonyl chloride?
The IUPAC name of 2-(2,4-difluorophenyl)-2-methylpropane-1-sulfonyl chloride (CID 116866432) is 2-(2,4-difluorophenyl)-2-methylpropane-1-sulfonyl chloride.
What is the SMILES notation for 2-(2,4-difluorophenyl)-2-methylpropane-1-sulfonyl chloride?
The canonical SMILES for 2-(2,4-difluorophenyl)-2-methylpropane-1-sulfonyl chloride is CC(C)(CS(=O)(=O)Cl)c1ccc(F)cc1F.
What is the InChIKey of 2-(2,4-difluorophenyl)-2-methylpropane-1-sulfonyl chloride?
The InChIKey is CAORMGUYQVSQAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClF2O2S/c1-10(2,6-16(11,14)15)8-4-3-7(12)5-9(8)13/h3-5H,6H2,1-2H3.
What are the key properties of 2-(2,4-difluorophenyl)-2-methylpropane-1-sulfonyl chloride?
2-(2,4-difluorophenyl)-2-methylpropane-1-sulfonyl chloride has a molecular weight of 268.71 g/mol, XLogP of 2.81, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-difluorophenyl)-2-methylpropane-1-sulfonyl chloride is sourced from PubChem (CID 116866432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).