C13H14ClNS — CID 116867883
2-(chloromethyl)-4-(3,4-dimethylphenyl)-5-methyl-1,3-thiazole (PubChem CID 116867883) has the molecular formula C13H14ClNS and a molecular weight of 251.78 g/mol. Its IUPAC name is 2-(chloromethyl)-4-(3,4-dimethylphenyl)-5-methyl-1,3-thiazole.
| Compound Name | 2-(chloromethyl)-4-(3,4-dimethylphenyl)-5-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 116867883 |
| Molecular Formula | C13H14ClNS |
| Molecular Weight | 251.78 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 2-(chloromethyl)-4-(3,4-dimethylphenyl)-5-methyl-1,3-thiazole |
| SMILES | Cc1ccc(-c2nc(CCl)sc2C)cc1C |
| InChI | InChI=1S/C13H14ClNS/c1-8-4-5-11(6-9(8)2)13-10(3)16-12(7-14)15-13/h4-6H,7H2,1-3H3 |
| InChIKey | RCBOAXUQTUQNEM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.78 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|