About (E)-3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]prop-2-enoic acid
(E)-3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]prop-2-enoic acid (PubChem CID 116868059) has the molecular formula C11H13NO3S
and a molecular weight of 239.30 g/mol. Its IUPAC name is (E)-3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]prop-2-enoic acid.
Molecular Properties
| Compound Name | (E)-3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]prop-2-enoic acid |
| PubChem CID | 116868059 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | (E)-3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1nc(C2CCOCC2)cs1 |
| InChI | InChI=1S/C11H13NO3S/c13-11(14)2-1-10-12-9(7-16-10)8-3-5-15-6-4-8/h1-2,7-8H,3-6H2,(H,13,14)/b2-1+ |
| InChIKey | XSMIMFWBAVGTPM-OWOJBTEDSA-N |
| XLogP | 2.13 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]prop-2-enoic acid?
The IUPAC name of (E)-3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]prop-2-enoic acid (CID 116868059) is (E)-3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]prop-2-enoic acid.
What is the SMILES notation for (E)-3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]prop-2-enoic acid?
The canonical SMILES for (E)-3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]prop-2-enoic acid is O=C(O)/C=C/c1nc(C2CCOCC2)cs1.
What is the InChIKey of (E)-3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]prop-2-enoic acid?
The InChIKey is XSMIMFWBAVGTPM-OWOJBTEDSA-N. The full InChI is InChI=1S/C11H13NO3S/c13-11(14)2-1-10-12-9(7-16-10)8-3-5-15-6-4-8/h1-2,7-8H,3-6H2,(H,13,14)/b2-1+.
What are the key properties of (E)-3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]prop-2-enoic acid?
(E)-3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]prop-2-enoic acid has a molecular weight of 239.30 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[4-(oxan-4-yl)-1,3-thiazol-2-yl]prop-2-enoic acid is sourced from PubChem (CID 116868059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).