C24H28N2O3S — CID 1168686
N-cyclohexyl-N-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]benzenesulfonamide (PubChem CID 1168686) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is N-cyclohexyl-N-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]benzenesulfonamide.
| Compound Name | N-cyclohexyl-N-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 1168686 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | N-cyclohexyl-N-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]benzenesulfonamide |
| SMILES | Cc1ccc2cc(CN(C3CCCCC3)S(=O)(=O)c3ccccc3)c(=O)[nH]c2c1C |
| InChI | InChI=1S/C24H28N2O3S/c1-17-13-14-19-15-20(24(27)25-23(19)18(17)2)16-26(21-9-5-3-6-10-21)30(28,29)22-11-7-4-8-12-22/h4,7-8,11-15,21H,3,5-6,9-10,16H2,1-2H3,(H,25,27) |
| InChIKey | ZAAAEQSCUCLYGH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |