About 3-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol
3-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol (PubChem CID 11686920) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is 3-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol.
Molecular Properties
| Compound Name | 3-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol |
| PubChem CID | 11686920 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 3-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol |
| SMILES | CC1=CC(O)C2OC2C1O |
| InChI | InChI=1S/C7H10O3/c1-3-2-4(8)6-7(10-6)5(3)9/h2,4-9H,1H3 |
| InChIKey | OICXPDKRWDNGQZ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol?
The IUPAC name of 3-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol (CID 11686920) is 3-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol.
What is the SMILES notation for 3-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol?
The canonical SMILES for 3-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol is CC1=CC(O)C2OC2C1O.
What is the InChIKey of 3-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol?
The InChIKey is OICXPDKRWDNGQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3/c1-3-2-4(8)6-7(10-6)5(3)9/h2,4-9H,1H3.
What are the key properties of 3-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol?
3-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol has a molecular weight of 142.15 g/mol, XLogP of -0.56, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol is sourced from PubChem (CID 11686920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).