dibutylphosphinous acid

C8H19OP — CID 11686957

IUPACdibutylphosphinous acid
SMILESCCCCP(O)CCCC
InChIInChI=1S/C8H19OP/c1-3-5-7-10(9)8-6-4-2/h9H,3-8H2,1-2H3
InChIKeyFOSKLGIMCJXUFR-UHFFFAOYSA-N
MW162.21 g/mol
LogP2.98
Rot. Bonds6

About dibutylphosphinous acid

dibutylphosphinous acid (PubChem CID 11686957) has the molecular formula C8H19OP and a molecular weight of 162.21 g/mol. Its IUPAC name is dibutylphosphinous acid.

Molecular Properties

Compound Namedibutylphosphinous acid
PubChem CID11686957
Molecular FormulaC8H19OP
Molecular Weight162.21 g/mol
Exact Mass162.12
IUPAC Namedibutylphosphinous acid
SMILESCCCCP(O)CCCC
InChIInChI=1S/C8H19OP/c1-3-5-7-10(9)8-6-4-2/h9H,3-8H2,1-2H3
InChIKeyFOSKLGIMCJXUFR-UHFFFAOYSA-N
XLogP2.98
TPSA20.23 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds6
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.21
LogP ≤ 52.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze dibutylphosphinous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dibutylphosphinous acid?
The IUPAC name of dibutylphosphinous acid (CID 11686957) is dibutylphosphinous acid.
What is the SMILES notation for dibutylphosphinous acid?
The canonical SMILES for dibutylphosphinous acid is CCCCP(O)CCCC.
What is the InChIKey of dibutylphosphinous acid?
The InChIKey is FOSKLGIMCJXUFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19OP/c1-3-5-7-10(9)8-6-4-2/h9H,3-8H2,1-2H3.
What are the key properties of dibutylphosphinous acid?
dibutylphosphinous acid has a molecular weight of 162.21 g/mol, XLogP of 2.98, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dibutylphosphinous acid is sourced from PubChem (CID 11686957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).