About 3-chloro-1,8-naphthyridine
3-chloro-1,8-naphthyridine (PubChem CID 11686962) has the molecular formula C8H5ClN2
and a molecular weight of 164.59 g/mol. Its IUPAC name is 3-chloro-1,8-naphthyridine.
Molecular Properties
| Compound Name | 3-chloro-1,8-naphthyridine |
| PubChem CID | 11686962 |
| Molecular Formula | C8H5ClN2 |
| Molecular Weight | 164.59 g/mol |
| Exact Mass | 164.01 |
| IUPAC Name | 3-chloro-1,8-naphthyridine |
| SMILES | Clc1cnc2ncccc2c1 |
| InChI | InChI=1S/C8H5ClN2/c9-7-4-6-2-1-3-10-8(6)11-5-7/h1-5H |
| InChIKey | JMXCJYDVRCEOMI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.59 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1,8-naphthyridine?
The IUPAC name of 3-chloro-1,8-naphthyridine (CID 11686962) is 3-chloro-1,8-naphthyridine.
What is the SMILES notation for 3-chloro-1,8-naphthyridine?
The canonical SMILES for 3-chloro-1,8-naphthyridine is Clc1cnc2ncccc2c1.
What is the InChIKey of 3-chloro-1,8-naphthyridine?
The InChIKey is JMXCJYDVRCEOMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClN2/c9-7-4-6-2-1-3-10-8(6)11-5-7/h1-5H.
What are the key properties of 3-chloro-1,8-naphthyridine?
3-chloro-1,8-naphthyridine has a molecular weight of 164.59 g/mol, XLogP of 2.28, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1,8-naphthyridine is sourced from PubChem (CID 11686962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).