About (5-methyl-1,2,4-oxadiazol-3-yl)-phenylmethanone
(5-methyl-1,2,4-oxadiazol-3-yl)-phenylmethanone (PubChem CID 11687022) has the molecular formula C10H8N2O2
and a molecular weight of 188.19 g/mol. Its IUPAC name is (5-methyl-1,2,4-oxadiazol-3-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (5-methyl-1,2,4-oxadiazol-3-yl)-phenylmethanone |
| PubChem CID | 11687022 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | (5-methyl-1,2,4-oxadiazol-3-yl)-phenylmethanone |
| SMILES | Cc1nc(C(=O)c2ccccc2)no1 |
| InChI | InChI=1S/C10H8N2O2/c1-7-11-10(12-14-7)9(13)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | BJHMEJXJPOBCNY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-methyl-1,2,4-oxadiazol-3-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-1,2,4-oxadiazol-3-yl)-phenylmethanone?
The IUPAC name of (5-methyl-1,2,4-oxadiazol-3-yl)-phenylmethanone (CID 11687022) is (5-methyl-1,2,4-oxadiazol-3-yl)-phenylmethanone.
What is the SMILES notation for (5-methyl-1,2,4-oxadiazol-3-yl)-phenylmethanone?
The canonical SMILES for (5-methyl-1,2,4-oxadiazol-3-yl)-phenylmethanone is Cc1nc(C(=O)c2ccccc2)no1.
What is the InChIKey of (5-methyl-1,2,4-oxadiazol-3-yl)-phenylmethanone?
The InChIKey is BJHMEJXJPOBCNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2/c1-7-11-10(12-14-7)9(13)8-5-3-2-4-6-8/h2-6H,1H3.
What are the key properties of (5-methyl-1,2,4-oxadiazol-3-yl)-phenylmethanone?
(5-methyl-1,2,4-oxadiazol-3-yl)-phenylmethanone has a molecular weight of 188.19 g/mol, XLogP of 1.61, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1,2,4-oxadiazol-3-yl)-phenylmethanone is sourced from PubChem (CID 11687022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).