About N-[[3-(2,4,5-trimethylphenyl)oxetan-3-yl]methyl]ethanamine
N-[[3-(2,4,5-trimethylphenyl)oxetan-3-yl]methyl]ethanamine (PubChem CID 116870511) has the molecular formula C15H23NO
and a molecular weight of 233.35 g/mol. Its IUPAC name is N-[[3-(2,4,5-trimethylphenyl)oxetan-3-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[3-(2,4,5-trimethylphenyl)oxetan-3-yl]methyl]ethanamine |
| PubChem CID | 116870511 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | N-[[3-(2,4,5-trimethylphenyl)oxetan-3-yl]methyl]ethanamine |
| SMILES | CCNCC1(c2cc(C)c(C)cc2C)COC1 |
| InChI | InChI=1S/C15H23NO/c1-5-16-8-15(9-17-10-15)14-7-12(3)11(2)6-13(14)4/h6-7,16H,5,8-10H2,1-4H3 |
| InChIKey | PWVDMNBNTQKNLR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[3-(2,4,5-trimethylphenyl)oxetan-3-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-(2,4,5-trimethylphenyl)oxetan-3-yl]methyl]ethanamine?
The IUPAC name of N-[[3-(2,4,5-trimethylphenyl)oxetan-3-yl]methyl]ethanamine (CID 116870511) is N-[[3-(2,4,5-trimethylphenyl)oxetan-3-yl]methyl]ethanamine.
What is the SMILES notation for N-[[3-(2,4,5-trimethylphenyl)oxetan-3-yl]methyl]ethanamine?
The canonical SMILES for N-[[3-(2,4,5-trimethylphenyl)oxetan-3-yl]methyl]ethanamine is CCNCC1(c2cc(C)c(C)cc2C)COC1.
What is the InChIKey of N-[[3-(2,4,5-trimethylphenyl)oxetan-3-yl]methyl]ethanamine?
The InChIKey is PWVDMNBNTQKNLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO/c1-5-16-8-15(9-17-10-15)14-7-12(3)11(2)6-13(14)4/h6-7,16H,5,8-10H2,1-4H3.
What are the key properties of N-[[3-(2,4,5-trimethylphenyl)oxetan-3-yl]methyl]ethanamine?
N-[[3-(2,4,5-trimethylphenyl)oxetan-3-yl]methyl]ethanamine has a molecular weight of 233.35 g/mol, XLogP of 2.49, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-(2,4,5-trimethylphenyl)oxetan-3-yl]methyl]ethanamine is sourced from PubChem (CID 116870511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).