C12H14ClFO2 — CID 116871701
3-[3-(3-chloro-4-fluorophenyl)oxetan-3-yl]propan-1-ol (PubChem CID 116871701) has the molecular formula C12H14ClFO2 and a molecular weight of 244.69 g/mol. Its IUPAC name is 3-[3-(3-chloro-4-fluorophenyl)oxetan-3-yl]propan-1-ol.
| Compound Name | 3-[3-(3-chloro-4-fluorophenyl)oxetan-3-yl]propan-1-ol |
|---|---|
| PubChem CID | 116871701 |
| Molecular Formula | C12H14ClFO2 |
| Molecular Weight | 244.69 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3-[3-(3-chloro-4-fluorophenyl)oxetan-3-yl]propan-1-ol |
| SMILES | OCCCC1(c2ccc(F)c(Cl)c2)COC1 |
| InChI | InChI=1S/C12H14ClFO2/c13-10-6-9(2-3-11(10)14)12(4-1-5-15)7-16-8-12/h2-3,6,15H,1,4-5,7-8H2 |
| InChIKey | KDLAEEVLFDRAMY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.69 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |