About [(E)-4,4-diethoxybut-1-enyl]benzene
[(E)-4,4-diethoxybut-1-enyl]benzene (PubChem CID 11687201) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is [(E)-4,4-diethoxybut-1-enyl]benzene.
Molecular Properties
| Compound Name | [(E)-4,4-diethoxybut-1-enyl]benzene |
| PubChem CID | 11687201 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | [(E)-4,4-diethoxybut-1-enyl]benzene |
| SMILES | CCOC(C/C=C/c1ccccc1)OCC |
| InChI | InChI=1S/C14H20O2/c1-3-15-14(16-4-2)12-8-11-13-9-6-5-7-10-13/h5-11,14H,3-4,12H2,1-2H3/b11-8+ |
| InChIKey | HJWJGMBHZDRVHW-DHZHZOJOSA-N |
| XLogP | 3.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(E)-4,4-diethoxybut-1-enyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-4,4-diethoxybut-1-enyl]benzene?
The IUPAC name of [(E)-4,4-diethoxybut-1-enyl]benzene (CID 11687201) is [(E)-4,4-diethoxybut-1-enyl]benzene.
What is the SMILES notation for [(E)-4,4-diethoxybut-1-enyl]benzene?
The canonical SMILES for [(E)-4,4-diethoxybut-1-enyl]benzene is CCOC(C/C=C/c1ccccc1)OCC.
What is the InChIKey of [(E)-4,4-diethoxybut-1-enyl]benzene?
The InChIKey is HJWJGMBHZDRVHW-DHZHZOJOSA-N. The full InChI is InChI=1S/C14H20O2/c1-3-15-14(16-4-2)12-8-11-13-9-6-5-7-10-13/h5-11,14H,3-4,12H2,1-2H3/b11-8+.
What are the key properties of [(E)-4,4-diethoxybut-1-enyl]benzene?
[(E)-4,4-diethoxybut-1-enyl]benzene has a molecular weight of 220.31 g/mol, XLogP of 3.49, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-4,4-diethoxybut-1-enyl]benzene is sourced from PubChem (CID 11687201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).