C15H20O4 — CID 116872053
2-[3-(4-methoxy-2,5-dimethylphenyl)oxetan-3-yl]propanoic acid (PubChem CID 116872053) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-[3-(4-methoxy-2,5-dimethylphenyl)oxetan-3-yl]propanoic acid.
| Compound Name | 2-[3-(4-methoxy-2,5-dimethylphenyl)oxetan-3-yl]propanoic acid |
|---|---|
| PubChem CID | 116872053 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-[3-(4-methoxy-2,5-dimethylphenyl)oxetan-3-yl]propanoic acid |
| SMILES | COc1cc(C)c(C2(C(C)C(=O)O)COC2)cc1C |
| InChI | InChI=1S/C15H20O4/c1-9-6-13(18-4)10(2)5-12(9)15(7-19-8-15)11(3)14(16)17/h5-6,11H,7-8H2,1-4H3,(H,16,17) |
| InChIKey | VVRMFGILDKLSHV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |