C9H16N2O5 — CID 11687281
2,4-dinitro-3-propylcyclohexan-1-ol (PubChem CID 11687281) has the molecular formula C9H16N2O5 and a molecular weight of 232.24 g/mol. Its IUPAC name is 2,4-dinitro-3-propylcyclohexan-1-ol.
| Compound Name | 2,4-dinitro-3-propylcyclohexan-1-ol |
|---|---|
| PubChem CID | 11687281 |
| Molecular Formula | C9H16N2O5 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 2,4-dinitro-3-propylcyclohexan-1-ol |
| SMILES | CCCC1C([N+](=O)[O-])CCC(O)C1[N+](=O)[O-] |
| InChI | InChI=1S/C9H16N2O5/c1-2-3-6-7(10(13)14)4-5-8(12)9(6)11(15)16/h6-9,12H,2-5H2,1H3 |
| InChIKey | CCQPTQBCNRZBTQ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|