C12H14O3S — CID 116872891
3-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)oxetane-3-thiol (PubChem CID 116872891) has the molecular formula C12H14O3S and a molecular weight of 238.31 g/mol. Its IUPAC name is 3-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)oxetane-3-thiol.
| Compound Name | 3-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)oxetane-3-thiol |
|---|---|
| PubChem CID | 116872891 |
| Molecular Formula | C12H14O3S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 3-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)oxetane-3-thiol |
| SMILES | Cc1cc2c(cc1C1(S)COC1)OCCO2 |
| InChI | InChI=1S/C12H14O3S/c1-8-4-10-11(15-3-2-14-10)5-9(8)12(16)6-13-7-12/h4-5,16H,2-3,6-7H2,1H3 |
| InChIKey | WULNDOFQYNESAH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|