About 4-[1-(4-chlorophenyl)ethyl]-1,2-dimethylbenzene
4-[1-(4-chlorophenyl)ethyl]-1,2-dimethylbenzene (PubChem CID 11687395) has the molecular formula C16H17Cl
and a molecular weight of 244.76 g/mol. Its IUPAC name is 4-[1-(4-chlorophenyl)ethyl]-1,2-dimethylbenzene.
Molecular Properties
| Compound Name | 4-[1-(4-chlorophenyl)ethyl]-1,2-dimethylbenzene |
| PubChem CID | 11687395 |
| Molecular Formula | C16H17Cl |
| Molecular Weight | 244.76 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 4-[1-(4-chlorophenyl)ethyl]-1,2-dimethylbenzene |
| SMILES | Cc1ccc(C(C)c2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C16H17Cl/c1-11-4-5-15(10-12(11)2)13(3)14-6-8-16(17)9-7-14/h4-10,13H,1-3H3 |
| InChIKey | IXKGQEVZDWFOBM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.76 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-[1-(4-chlorophenyl)ethyl]-1,2-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(4-chlorophenyl)ethyl]-1,2-dimethylbenzene?
The IUPAC name of 4-[1-(4-chlorophenyl)ethyl]-1,2-dimethylbenzene (CID 11687395) is 4-[1-(4-chlorophenyl)ethyl]-1,2-dimethylbenzene.
What is the SMILES notation for 4-[1-(4-chlorophenyl)ethyl]-1,2-dimethylbenzene?
The canonical SMILES for 4-[1-(4-chlorophenyl)ethyl]-1,2-dimethylbenzene is Cc1ccc(C(C)c2ccc(Cl)cc2)cc1C.
What is the InChIKey of 4-[1-(4-chlorophenyl)ethyl]-1,2-dimethylbenzene?
The InChIKey is IXKGQEVZDWFOBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17Cl/c1-11-4-5-15(10-12(11)2)13(3)14-6-8-16(17)9-7-14/h4-10,13H,1-3H3.
What are the key properties of 4-[1-(4-chlorophenyl)ethyl]-1,2-dimethylbenzene?
4-[1-(4-chlorophenyl)ethyl]-1,2-dimethylbenzene has a molecular weight of 244.76 g/mol, XLogP of 5.11, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(4-chlorophenyl)ethyl]-1,2-dimethylbenzene is sourced from PubChem (CID 11687395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).