C14H17NO3 — CID 11687424
(1R,6S,7R,11S)-8-azatetracyclo[6.5.2.01,6.07,11]pentadecane-9,10,14-trione (PubChem CID 11687424) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is (1R,6S,7R,11S)-8-azatetracyclo[6.5.2.01,6.07,11]pentadecane-9,10,14-trione.
| Compound Name | (1R,6S,7R,11S)-8-azatetracyclo[6.5.2.01,6.07,11]pentadecane-9,10,14-trione |
|---|---|
| PubChem CID | 11687424 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (1R,6S,7R,11S)-8-azatetracyclo[6.5.2.01,6.07,11]pentadecane-9,10,14-trione |
| SMILES | O=C1C(=O)N2CC(=O)[C@@]34CCCC[C@@H]3[C@@H]2[C@@H]1CC4 |
| InChI | InChI=1S/C14H17NO3/c16-10-7-15-11-8(12(17)13(15)18)4-6-14(10)5-2-1-3-9(11)14/h8-9,11H,1-7H2/t8-,9+,11-,14+/m0/s1 |
| InChIKey | WZRULGRMARFOOK-XHEDZOQISA-N |
| XLogP | 0.94 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|