C12H17NOS — CID 116874842
[1-[3-(3-methylthiophen-2-yl)oxetan-3-yl]cyclopropyl]methanamine (PubChem CID 116874842) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is [1-[3-(3-methylthiophen-2-yl)oxetan-3-yl]cyclopropyl]methanamine.
| Compound Name | [1-[3-(3-methylthiophen-2-yl)oxetan-3-yl]cyclopropyl]methanamine |
|---|---|
| PubChem CID | 116874842 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | [1-[3-(3-methylthiophen-2-yl)oxetan-3-yl]cyclopropyl]methanamine |
| SMILES | Cc1ccsc1C1(C2(CN)CC2)COC1 |
| InChI | InChI=1S/C12H17NOS/c1-9-2-5-15-10(9)12(7-14-8-12)11(6-13)3-4-11/h2,5H,3-4,6-8,13H2,1H3 |
| InChIKey | QNBHUOSMZUEAMF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |