C17H17N3 — CID 11687579
4-(1H-indazol-6-yl)-2-methyl-3,4-dihydro-1H-isoquinoline (PubChem CID 11687579) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-(1H-indazol-6-yl)-2-methyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 4-(1H-indazol-6-yl)-2-methyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 11687579 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 4-(1H-indazol-6-yl)-2-methyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CN1Cc2ccccc2C(c2ccc3cn[nH]c3c2)C1 |
| InChI | InChI=1S/C17H17N3/c1-20-10-14-4-2-3-5-15(14)16(11-20)12-6-7-13-9-18-19-17(13)8-12/h2-9,16H,10-11H2,1H3,(H,18,19) |
| InChIKey | DYQBWKPHLQJDJC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |