C16H23BO3 — CID 11687690
(6S)-6-[(E)-3-[(2S,6S)-6-ethenyl-4-methylideneoxan-2-yl]prop-1-enyl]-2-hydroxy-4-methyl-5,6-dihydrooxaborinine (PubChem CID 11687690) has the molecular formula C16H23BO3 and a molecular weight of 274.17 g/mol. Its IUPAC name is (6S)-6-[(E)-3-[(2S,6S)-6-ethenyl-4-methylideneoxan-2-yl]prop-1-enyl]-2-hydroxy-4-methyl-5,6-dihydrooxaborinine.
| Compound Name | (6S)-6-[(E)-3-[(2S,6S)-6-ethenyl-4-methylideneoxan-2-yl]prop-1-enyl]-2-hydroxy-4-methyl-5,6-dihydrooxaborinine |
|---|---|
| PubChem CID | 11687690 |
| Molecular Formula | C16H23BO3 |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (6S)-6-[(E)-3-[(2S,6S)-6-ethenyl-4-methylideneoxan-2-yl]prop-1-enyl]-2-hydroxy-4-methyl-5,6-dihydrooxaborinine |
| SMILES | C=C[C@@H]1CC(=C)C[C@H](C/C=C/[C@@H]2CC(C)=CB(O)O2)O1 |
| InChI | InChI=1S/C16H23BO3/c1-4-14-8-12(2)9-15(19-14)6-5-7-16-10-13(3)11-17(18)20-16/h4-5,7,11,14-16,18H,1-2,6,8-10H2,3H3/b7-5+/t14-,15+,16-/m1/s1 |
| InChIKey | SGCNRQNLQHHYDE-LHZLUDBRSA-N |
| XLogP | 2.98 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|