About 3-[5-(2,3,4-trimethylphenyl)-1H-imidazol-2-yl]butan-1-amine
3-[5-(2,3,4-trimethylphenyl)-1H-imidazol-2-yl]butan-1-amine (PubChem CID 116877009) has the molecular formula C16H23N3
and a molecular weight of 257.38 g/mol. Its IUPAC name is 3-[5-(2,3,4-trimethylphenyl)-1H-imidazol-2-yl]butan-1-amine.
Molecular Properties
| Compound Name | 3-[5-(2,3,4-trimethylphenyl)-1H-imidazol-2-yl]butan-1-amine |
| PubChem CID | 116877009 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 3-[5-(2,3,4-trimethylphenyl)-1H-imidazol-2-yl]butan-1-amine |
| SMILES | Cc1ccc(-c2cnc(C(C)CCN)[nH]2)c(C)c1C |
| InChI | InChI=1S/C16H23N3/c1-10-5-6-14(13(4)12(10)3)15-9-18-16(19-15)11(2)7-8-17/h5-6,9,11H,7-8,17H2,1-4H3,(H,18,19) |
| InChIKey | NFGKUGIFHMTWSF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[5-(2,3,4-trimethylphenyl)-1H-imidazol-2-yl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(2,3,4-trimethylphenyl)-1H-imidazol-2-yl]butan-1-amine?
The IUPAC name of 3-[5-(2,3,4-trimethylphenyl)-1H-imidazol-2-yl]butan-1-amine (CID 116877009) is 3-[5-(2,3,4-trimethylphenyl)-1H-imidazol-2-yl]butan-1-amine.
What is the SMILES notation for 3-[5-(2,3,4-trimethylphenyl)-1H-imidazol-2-yl]butan-1-amine?
The canonical SMILES for 3-[5-(2,3,4-trimethylphenyl)-1H-imidazol-2-yl]butan-1-amine is Cc1ccc(-c2cnc(C(C)CCN)[nH]2)c(C)c1C.
What is the InChIKey of 3-[5-(2,3,4-trimethylphenyl)-1H-imidazol-2-yl]butan-1-amine?
The InChIKey is NFGKUGIFHMTWSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3/c1-10-5-6-14(13(4)12(10)3)15-9-18-16(19-15)11(2)7-8-17/h5-6,9,11H,7-8,17H2,1-4H3,(H,18,19).
What are the key properties of 3-[5-(2,3,4-trimethylphenyl)-1H-imidazol-2-yl]butan-1-amine?
3-[5-(2,3,4-trimethylphenyl)-1H-imidazol-2-yl]butan-1-amine has a molecular weight of 257.38 g/mol, XLogP of 3.45, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(2,3,4-trimethylphenyl)-1H-imidazol-2-yl]butan-1-amine is sourced from PubChem (CID 116877009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).