C11H12N2O2S — CID 116878655
3-[5-(3-methylthiophen-2-yl)-1H-imidazol-2-yl]propanoic acid (PubChem CID 116878655) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 3-[5-(3-methylthiophen-2-yl)-1H-imidazol-2-yl]propanoic acid.
| Compound Name | 3-[5-(3-methylthiophen-2-yl)-1H-imidazol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 116878655 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 3-[5-(3-methylthiophen-2-yl)-1H-imidazol-2-yl]propanoic acid |
| SMILES | Cc1ccsc1-c1cnc(CCC(=O)O)[nH]1 |
| InChI | InChI=1S/C11H12N2O2S/c1-7-4-5-16-11(7)8-6-12-9(13-8)2-3-10(14)15/h4-6H,2-3H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | CDECBOIQEBZOCZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |