C15H18O6 — CID 11687934
trimethyl (3aR,7aS)-2,3-dihydro-1H-indene-3a,5,7a-tricarboxylate (PubChem CID 11687934) has the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. Its IUPAC name is trimethyl (3aR,7aS)-2,3-dihydro-1H-indene-3a,5,7a-tricarboxylate.
| Compound Name | trimethyl (3aR,7aS)-2,3-dihydro-1H-indene-3a,5,7a-tricarboxylate |
|---|---|
| PubChem CID | 11687934 |
| Molecular Formula | C15H18O6 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | trimethyl (3aR,7aS)-2,3-dihydro-1H-indene-3a,5,7a-tricarboxylate |
| SMILES | COC(=O)C1=C[C@]2(C(=O)OC)CCC[C@]2(C(=O)OC)C=C1 |
| InChI | InChI=1S/C15H18O6/c1-19-11(16)10-5-8-14(12(17)20-2)6-4-7-15(14,9-10)13(18)21-3/h5,8-9H,4,6-7H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | LSKBAYMAXLYFGJ-CABCVRRESA-N |
| XLogP | 1.16 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|