C10H6Cl3NO3 — CID 11687949
4,5-Dihydro-3-(2,3,6-trichlorophenyl)isoxazole-5-carboxylic acid (PubChem CID 11687949) has the molecular formula C10H6Cl3NO3 and a molecular weight of 294.50 g/mol. Its IUPAC name is 3-(2,3,6-trichlorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid.
| Compound Name | 4,5-Dihydro-3-(2,3,6-trichlorophenyl)isoxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 11687949 |
| Molecular Formula | C10H6Cl3NO3 |
| Molecular Weight | 294.50 g/mol |
| Exact Mass | 292.94 |
| IUPAC Name | 3-(2,3,6-trichlorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
| SMILES | C1C(ON=C1C2=C(C=CC(=C2Cl)Cl)Cl)C(=O)O |
| InChI | InChI=1S/C10H6Cl3NO3/c11-4-1-2-5(12)9(13)8(4)6-3-7(10(15)16)17-14-6/h1-2,7H,3H2,(H,15,16) |
| InChIKey | SIJYUZYNMHARKA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | 350 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|