C7H5ClN2OS — CID 116879669
4-(5-chlorothiophen-2-yl)-1,3-dihydroimidazol-2-one (PubChem CID 116879669) has the molecular formula C7H5ClN2OS and a molecular weight of 200.65 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)-1,3-dihydroimidazol-2-one.
| Compound Name | 4-(5-chlorothiophen-2-yl)-1,3-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 116879669 |
| Molecular Formula | C7H5ClN2OS |
| Molecular Weight | 200.65 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)-1,3-dihydroimidazol-2-one |
| SMILES | O=c1[nH]cc(-c2ccc(Cl)s2)[nH]1 |
| InChI | InChI=1S/C7H5ClN2OS/c8-6-2-1-5(12-6)4-3-9-7(11)10-4/h1-3H,(H2,9,10,11) |
| InChIKey | OOHVMLAIGJUEPY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.65 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |