About 4-naphthalen-1-yl-1,3-dihydroimidazol-2-one
4-naphthalen-1-yl-1,3-dihydroimidazol-2-one (PubChem CID 116879771) has the molecular formula C13H10N2O
and a molecular weight of 210.24 g/mol. Its IUPAC name is 4-naphthalen-1-yl-1,3-dihydroimidazol-2-one.
Molecular Properties
| Compound Name | 4-naphthalen-1-yl-1,3-dihydroimidazol-2-one |
| PubChem CID | 116879771 |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 4-naphthalen-1-yl-1,3-dihydroimidazol-2-one |
| SMILES | O=c1[nH]cc(-c2cccc3ccccc23)[nH]1 |
| InChI | InChI=1S/C13H10N2O/c16-13-14-8-12(15-13)11-7-3-5-9-4-1-2-6-10(9)11/h1-8H,(H2,14,15,16) |
| InChIKey | JBYMYKSVSBUPQD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-naphthalen-1-yl-1,3-dihydroimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-naphthalen-1-yl-1,3-dihydroimidazol-2-one?
The IUPAC name of 4-naphthalen-1-yl-1,3-dihydroimidazol-2-one (CID 116879771) is 4-naphthalen-1-yl-1,3-dihydroimidazol-2-one.
What is the SMILES notation for 4-naphthalen-1-yl-1,3-dihydroimidazol-2-one?
The canonical SMILES for 4-naphthalen-1-yl-1,3-dihydroimidazol-2-one is O=c1[nH]cc(-c2cccc3ccccc23)[nH]1.
What is the InChIKey of 4-naphthalen-1-yl-1,3-dihydroimidazol-2-one?
The InChIKey is JBYMYKSVSBUPQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O/c16-13-14-8-12(15-13)11-7-3-5-9-4-1-2-6-10(9)11/h1-8H,(H2,14,15,16).
What are the key properties of 4-naphthalen-1-yl-1,3-dihydroimidazol-2-one?
4-naphthalen-1-yl-1,3-dihydroimidazol-2-one has a molecular weight of 210.24 g/mol, XLogP of 2.52, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-naphthalen-1-yl-1,3-dihydroimidazol-2-one is sourced from PubChem (CID 116879771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).