C11H7ClFN3 — CID 116879963
5-(2-chloro-5-fluoro-4-methylphenyl)-1H-imidazole-2-carbonitrile (PubChem CID 116879963) has the molecular formula C11H7ClFN3 and a molecular weight of 235.65 g/mol. Its IUPAC name is 5-(2-chloro-5-fluoro-4-methylphenyl)-1H-imidazole-2-carbonitrile.
| Compound Name | 5-(2-chloro-5-fluoro-4-methylphenyl)-1H-imidazole-2-carbonitrile |
|---|---|
| PubChem CID | 116879963 |
| Molecular Formula | C11H7ClFN3 |
| Molecular Weight | 235.65 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | 5-(2-chloro-5-fluoro-4-methylphenyl)-1H-imidazole-2-carbonitrile |
| SMILES | Cc1cc(Cl)c(-c2cnc(C#N)[nH]2)cc1F |
| InChI | InChI=1S/C11H7ClFN3/c1-6-2-8(12)7(3-9(6)13)10-5-15-11(4-14)16-10/h2-3,5H,1H3,(H,15,16) |
| InChIKey | BCKSLMDRRLJFLV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.65 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |