C14H15N3 — CID 116880113
3-[5-(4-ethylphenyl)-1H-imidazol-2-yl]propanenitrile (PubChem CID 116880113) has the molecular formula C14H15N3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-[5-(4-ethylphenyl)-1H-imidazol-2-yl]propanenitrile.
| Compound Name | 3-[5-(4-ethylphenyl)-1H-imidazol-2-yl]propanenitrile |
|---|---|
| PubChem CID | 116880113 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 3-[5-(4-ethylphenyl)-1H-imidazol-2-yl]propanenitrile |
| SMILES | CCc1ccc(-c2cnc(CCC#N)[nH]2)cc1 |
| InChI | InChI=1S/C14H15N3/c1-2-11-5-7-12(8-6-11)13-10-16-14(17-13)4-3-9-15/h5-8,10H,2-4H2,1H3,(H,16,17) |
| InChIKey | ZIFPMXAXKUQKNY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |