About [(1R)-1-[(2Z,3S)-2-(2-ethoxy-2-oxoethylidene)-4-oxoazetidin-3-yl]ethyl] benzoate
[(1R)-1-[(2Z,3S)-2-(2-ethoxy-2-oxoethylidene)-4-oxoazetidin-3-yl]ethyl] benzoate (PubChem CID 11688072) has the molecular formula C16H17NO5
and a molecular weight of 303.31 g/mol. Its IUPAC name is [(1R)-1-[(2Z,3S)-2-(2-ethoxy-2-oxoethylidene)-4-oxoazetidin-3-yl]ethyl] benzoate.
Molecular Properties
| Compound Name | [(1R)-1-[(2Z,3S)-2-(2-ethoxy-2-oxoethylidene)-4-oxoazetidin-3-yl]ethyl] benzoate |
| PubChem CID | 11688072 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | [(1R)-1-[(2Z,3S)-2-(2-ethoxy-2-oxoethylidene)-4-oxoazetidin-3-yl]ethyl] benzoate |
| SMILES | CCOC(=O)/C=C1\NC(=O)[C@@H]1[C@@H](C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H17NO5/c1-3-21-13(18)9-12-14(15(19)17-12)10(2)22-16(20)11-7-5-4-6-8-11/h4-10,14H,3H2,1-2H3,(H,17,19)/b12-9-/t10-,14-/m1/s1 |
| InChIKey | SQGWGRYJQCPJBE-IFYRVJTJSA-N |
| XLogP | 1.42 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-[(2Z,3S)-2-(2-ethoxy-2-oxoethylidene)-4-oxoazetidin-3-yl]ethyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-[(2Z,3S)-2-(2-ethoxy-2-oxoethylidene)-4-oxoazetidin-3-yl]ethyl] benzoate?
The IUPAC name of [(1R)-1-[(2Z,3S)-2-(2-ethoxy-2-oxoethylidene)-4-oxoazetidin-3-yl]ethyl] benzoate (CID 11688072) is [(1R)-1-[(2Z,3S)-2-(2-ethoxy-2-oxoethylidene)-4-oxoazetidin-3-yl]ethyl] benzoate.
What is the SMILES notation for [(1R)-1-[(2Z,3S)-2-(2-ethoxy-2-oxoethylidene)-4-oxoazetidin-3-yl]ethyl] benzoate?
The canonical SMILES for [(1R)-1-[(2Z,3S)-2-(2-ethoxy-2-oxoethylidene)-4-oxoazetidin-3-yl]ethyl] benzoate is CCOC(=O)/C=C1\NC(=O)[C@@H]1[C@@H](C)OC(=O)c1ccccc1.
What is the InChIKey of [(1R)-1-[(2Z,3S)-2-(2-ethoxy-2-oxoethylidene)-4-oxoazetidin-3-yl]ethyl] benzoate?
The InChIKey is SQGWGRYJQCPJBE-IFYRVJTJSA-N. The full InChI is InChI=1S/C16H17NO5/c1-3-21-13(18)9-12-14(15(19)17-12)10(2)22-16(20)11-7-5-4-6-8-11/h4-10,14H,3H2,1-2H3,(H,17,19)/b12-9-/t10-,14-/m1/s1.
What are the key properties of [(1R)-1-[(2Z,3S)-2-(2-ethoxy-2-oxoethylidene)-4-oxoazetidin-3-yl]ethyl] benzoate?
[(1R)-1-[(2Z,3S)-2-(2-ethoxy-2-oxoethylidene)-4-oxoazetidin-3-yl]ethyl] benzoate has a molecular weight of 303.31 g/mol, XLogP of 1.42, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-[(2Z,3S)-2-(2-ethoxy-2-oxoethylidene)-4-oxoazetidin-3-yl]ethyl] benzoate is sourced from PubChem (CID 11688072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).