About (4S)-3-[(2S,3R)-7-chloro-3-hydroxy-2-methylheptanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one
(4S)-3-[(2S,3R)-7-chloro-3-hydroxy-2-methylheptanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 11688093) has the molecular formula C14H24ClNO4
and a molecular weight of 305.80 g/mol. Its IUPAC name is (4S)-3-[(2S,3R)-7-chloro-3-hydroxy-2-methylheptanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (4S)-3-[(2S,3R)-7-chloro-3-hydroxy-2-methylheptanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| PubChem CID | 11688093 |
| Molecular Formula | C14H24ClNO4 |
| Molecular Weight | 305.80 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (4S)-3-[(2S,3R)-7-chloro-3-hydroxy-2-methylheptanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@H]1COC(=O)N1C(=O)[C@@H](C)[C@H](O)CCCCCl |
| InChI | InChI=1S/C14H24ClNO4/c1-9(2)11-8-20-14(19)16(11)13(18)10(3)12(17)6-4-5-7-15/h9-12,17H,4-8H2,1-3H3/t10-,11+,12+/m0/s1 |
| InChIKey | JZWOIXVJYMJDTJ-QJPTWQEYSA-N |
| XLogP | 2.40 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.80 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (4S)-3-[(2S,3R)-7-chloro-3-hydroxy-2-methylheptanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-3-[(2S,3R)-7-chloro-3-hydroxy-2-methylheptanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one?
The IUPAC name of (4S)-3-[(2S,3R)-7-chloro-3-hydroxy-2-methylheptanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one (CID 11688093) is (4S)-3-[(2S,3R)-7-chloro-3-hydroxy-2-methylheptanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
What is the SMILES notation for (4S)-3-[(2S,3R)-7-chloro-3-hydroxy-2-methylheptanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one?
The canonical SMILES for (4S)-3-[(2S,3R)-7-chloro-3-hydroxy-2-methylheptanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one is CC(C)[C@H]1COC(=O)N1C(=O)[C@@H](C)[C@H](O)CCCCCl.
What is the InChIKey of (4S)-3-[(2S,3R)-7-chloro-3-hydroxy-2-methylheptanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one?
The InChIKey is JZWOIXVJYMJDTJ-QJPTWQEYSA-N. The full InChI is InChI=1S/C14H24ClNO4/c1-9(2)11-8-20-14(19)16(11)13(18)10(3)12(17)6-4-5-7-15/h9-12,17H,4-8H2,1-3H3/t10-,11+,12+/m0/s1.
What are the key properties of (4S)-3-[(2S,3R)-7-chloro-3-hydroxy-2-methylheptanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one?
(4S)-3-[(2S,3R)-7-chloro-3-hydroxy-2-methylheptanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one has a molecular weight of 305.80 g/mol, XLogP of 2.40, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-3-[(2S,3R)-7-chloro-3-hydroxy-2-methylheptanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one is sourced from PubChem (CID 11688093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).