C9H10BrN3OS — CID 116881580
2-amino-2-[5-(4-bromothiophen-2-yl)-1H-imidazol-2-yl]ethanol (PubChem CID 116881580) has the molecular formula C9H10BrN3OS and a molecular weight of 288.17 g/mol. Its IUPAC name is 2-amino-2-[5-(4-bromothiophen-2-yl)-1H-imidazol-2-yl]ethanol.
| Compound Name | 2-amino-2-[5-(4-bromothiophen-2-yl)-1H-imidazol-2-yl]ethanol |
|---|---|
| PubChem CID | 116881580 |
| Molecular Formula | C9H10BrN3OS |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 286.97 |
| IUPAC Name | 2-amino-2-[5-(4-bromothiophen-2-yl)-1H-imidazol-2-yl]ethanol |
| SMILES | NC(CO)c1ncc(-c2cc(Br)cs2)[nH]1 |
| InChI | InChI=1S/C9H10BrN3OS/c10-5-1-8(15-4-5)7-2-12-9(13-7)6(11)3-14/h1-2,4,6,14H,3,11H2,(H,12,13) |
| InChIKey | NWVFEUNOEJSYSF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |