C15H12N4O4 — CID 11688187
5-[(2,4-dioxo-1H-pyrimidin-5-yl)-phenylmethyl]-1H-pyrimidine-2,4-dione (PubChem CID 11688187) has the molecular formula C15H12N4O4 and a molecular weight of 312.29 g/mol. Its IUPAC name is 5-[(2,4-dioxo-1H-pyrimidin-5-yl)-phenylmethyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(2,4-dioxo-1H-pyrimidin-5-yl)-phenylmethyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11688187 |
| Molecular Formula | C15H12N4O4 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 5-[(2,4-dioxo-1H-pyrimidin-5-yl)-phenylmethyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(C(c2ccccc2)c2c[nH]c(=O)[nH]c2=O)c(=O)[nH]1 |
| InChI | InChI=1S/C15H12N4O4/c20-12-9(6-16-14(22)18-12)11(8-4-2-1-3-5-8)10-7-17-15(23)19-13(10)21/h1-7,11H,(H2,16,18,20,22)(H2,17,19,21,23) |
| InChIKey | VZQXRKOEKUTFOT-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 131.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |