About 1-[1-[5-(2,3-dihydro-1H-inden-5-yl)-1H-imidazol-2-yl]cyclopropyl]-N-methylmethanamine
1-[1-[5-(2,3-dihydro-1H-inden-5-yl)-1H-imidazol-2-yl]cyclopropyl]-N-methylmethanamine (PubChem CID 116882176) has the molecular formula C17H21N3
and a molecular weight of 267.38 g/mol. Its IUPAC name is 1-[1-[5-(2,3-dihydro-1H-inden-5-yl)-1H-imidazol-2-yl]cyclopropyl]-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-[1-[5-(2,3-dihydro-1H-inden-5-yl)-1H-imidazol-2-yl]cyclopropyl]-N-methylmethanamine |
| PubChem CID | 116882176 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 1-[1-[5-(2,3-dihydro-1H-inden-5-yl)-1H-imidazol-2-yl]cyclopropyl]-N-methylmethanamine |
| SMILES | CNCC1(c2ncc(-c3ccc4c(c3)CCC4)[nH]2)CC1 |
| InChI | InChI=1S/C17H21N3/c1-18-11-17(7-8-17)16-19-10-15(20-16)14-6-5-12-3-2-4-13(12)9-14/h5-6,9-10,18H,2-4,7-8,11H2,1H3,(H,19,20) |
| InChIKey | VUJMJYSYJFUBIC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[1-[5-(2,3-dihydro-1H-inden-5-yl)-1H-imidazol-2-yl]cyclopropyl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[5-(2,3-dihydro-1H-inden-5-yl)-1H-imidazol-2-yl]cyclopropyl]-N-methylmethanamine?
The IUPAC name of 1-[1-[5-(2,3-dihydro-1H-inden-5-yl)-1H-imidazol-2-yl]cyclopropyl]-N-methylmethanamine (CID 116882176) is 1-[1-[5-(2,3-dihydro-1H-inden-5-yl)-1H-imidazol-2-yl]cyclopropyl]-N-methylmethanamine.
What is the SMILES notation for 1-[1-[5-(2,3-dihydro-1H-inden-5-yl)-1H-imidazol-2-yl]cyclopropyl]-N-methylmethanamine?
The canonical SMILES for 1-[1-[5-(2,3-dihydro-1H-inden-5-yl)-1H-imidazol-2-yl]cyclopropyl]-N-methylmethanamine is CNCC1(c2ncc(-c3ccc4c(c3)CCC4)[nH]2)CC1.
What is the InChIKey of 1-[1-[5-(2,3-dihydro-1H-inden-5-yl)-1H-imidazol-2-yl]cyclopropyl]-N-methylmethanamine?
The InChIKey is VUJMJYSYJFUBIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3/c1-18-11-17(7-8-17)16-19-10-15(20-16)14-6-5-12-3-2-4-13(12)9-14/h5-6,9-10,18H,2-4,7-8,11H2,1H3,(H,19,20).
What are the key properties of 1-[1-[5-(2,3-dihydro-1H-inden-5-yl)-1H-imidazol-2-yl]cyclopropyl]-N-methylmethanamine?
1-[1-[5-(2,3-dihydro-1H-inden-5-yl)-1H-imidazol-2-yl]cyclopropyl]-N-methylmethanamine has a molecular weight of 267.38 g/mol, XLogP of 2.82, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[5-(2,3-dihydro-1H-inden-5-yl)-1H-imidazol-2-yl]cyclopropyl]-N-methylmethanamine is sourced from PubChem (CID 116882176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).