C16H32O4Si — CID 11688270
(2S)-2-[(2S,5R)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]oxolan-2-yl]propanoic acid (PubChem CID 11688270) has the molecular formula C16H32O4Si and a molecular weight of 316.51 g/mol. Its IUPAC name is (2S)-2-[(2S,5R)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]oxolan-2-yl]propanoic acid.
| Compound Name | (2S)-2-[(2S,5R)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]oxolan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 11688270 |
| Molecular Formula | C16H32O4Si |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | (2S)-2-[(2S,5R)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]oxolan-2-yl]propanoic acid |
| SMILES | C[C@H](C[C@H]1CC[C@@H]([C@H](C)C(=O)O)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O4Si/c1-11(20-21(6,7)16(3,4)5)10-13-8-9-14(19-13)12(2)15(17)18/h11-14H,8-10H2,1-7H3,(H,17,18)/t11-,12+,13-,14+/m1/s1 |
| InChIKey | PIFFQQGCUJWXOC-RQJABVFESA-N |
| XLogP | 4.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|