C13H23N3O — CID 116883007
3-methyl-2-[5-(oxan-4-yl)-1H-imidazol-2-yl]butan-1-amine (PubChem CID 116883007) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 3-methyl-2-[5-(oxan-4-yl)-1H-imidazol-2-yl]butan-1-amine.
| Compound Name | 3-methyl-2-[5-(oxan-4-yl)-1H-imidazol-2-yl]butan-1-amine |
|---|---|
| PubChem CID | 116883007 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 3-methyl-2-[5-(oxan-4-yl)-1H-imidazol-2-yl]butan-1-amine |
| SMILES | CC(C)C(CN)c1ncc(C2CCOCC2)[nH]1 |
| InChI | InChI=1S/C13H23N3O/c1-9(2)11(7-14)13-15-8-12(16-13)10-3-5-17-6-4-10/h8-11H,3-7,14H2,1-2H3,(H,15,16) |
| InChIKey | PNUWCKLBWWNCEJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |