About 3-(4-methyl-2-propyl-1,3-thiazol-5-yl)aniline
3-(4-methyl-2-propyl-1,3-thiazol-5-yl)aniline (PubChem CID 116885231) has the molecular formula C13H16N2S
and a molecular weight of 232.35 g/mol. Its IUPAC name is 3-(4-methyl-2-propyl-1,3-thiazol-5-yl)aniline.
Molecular Properties
| Compound Name | 3-(4-methyl-2-propyl-1,3-thiazol-5-yl)aniline |
| PubChem CID | 116885231 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 3-(4-methyl-2-propyl-1,3-thiazol-5-yl)aniline |
| SMILES | CCCc1nc(C)c(-c2cccc(N)c2)s1 |
| InChI | InChI=1S/C13H16N2S/c1-3-5-12-15-9(2)13(16-12)10-6-4-7-11(14)8-10/h4,6-8H,3,5,14H2,1-2H3 |
| InChIKey | LTUXBXUXBWUCCF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-methyl-2-propyl-1,3-thiazol-5-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methyl-2-propyl-1,3-thiazol-5-yl)aniline?
The IUPAC name of 3-(4-methyl-2-propyl-1,3-thiazol-5-yl)aniline (CID 116885231) is 3-(4-methyl-2-propyl-1,3-thiazol-5-yl)aniline.
What is the SMILES notation for 3-(4-methyl-2-propyl-1,3-thiazol-5-yl)aniline?
The canonical SMILES for 3-(4-methyl-2-propyl-1,3-thiazol-5-yl)aniline is CCCc1nc(C)c(-c2cccc(N)c2)s1.
What is the InChIKey of 3-(4-methyl-2-propyl-1,3-thiazol-5-yl)aniline?
The InChIKey is LTUXBXUXBWUCCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2S/c1-3-5-12-15-9(2)13(16-12)10-6-4-7-11(14)8-10/h4,6-8H,3,5,14H2,1-2H3.
What are the key properties of 3-(4-methyl-2-propyl-1,3-thiazol-5-yl)aniline?
3-(4-methyl-2-propyl-1,3-thiazol-5-yl)aniline has a molecular weight of 232.35 g/mol, XLogP of 3.65, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methyl-2-propyl-1,3-thiazol-5-yl)aniline is sourced from PubChem (CID 116885231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).