C14H15NOS — CID 116885687
4-methyl-2-(2,3,4-trimethylphenyl)-1,3-thiazole-5-carbaldehyde (PubChem CID 116885687) has the molecular formula C14H15NOS and a molecular weight of 245.35 g/mol. Its IUPAC name is 4-methyl-2-(2,3,4-trimethylphenyl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-methyl-2-(2,3,4-trimethylphenyl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 116885687 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 4-methyl-2-(2,3,4-trimethylphenyl)-1,3-thiazole-5-carbaldehyde |
| SMILES | Cc1ccc(-c2nc(C)c(C=O)s2)c(C)c1C |
| InChI | InChI=1S/C14H15NOS/c1-8-5-6-12(10(3)9(8)2)14-15-11(4)13(7-16)17-14/h5-7H,1-4H3 |
| InChIKey | SYUGIERNROWCAJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|