C10H12F10O — CID 11688646
1,1,2,2,3,3,4,4,5,5-decafluoro-1-pentoxypentane (PubChem CID 11688646) has the molecular formula C10H12F10O and a molecular weight of 338.19 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5-decafluoro-1-pentoxypentane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5-decafluoro-1-pentoxypentane |
|---|---|
| PubChem CID | 11688646 |
| Molecular Formula | C10H12F10O |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5-decafluoro-1-pentoxypentane |
| SMILES | CCCCCOC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H12F10O/c1-2-3-4-5-21-10(19,20)9(17,18)8(15,16)7(13,14)6(11)12/h6H,2-5H2,1H3 |
| InChIKey | RQVZOCYJLSJQTB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|