C14H14BrNOS — CID 116886477
4-[2-(2-bromophenyl)-4-methyl-1,3-thiazol-5-yl]butan-2-one (PubChem CID 116886477) has the molecular formula C14H14BrNOS and a molecular weight of 324.24 g/mol. Its IUPAC name is 4-[2-(2-bromophenyl)-4-methyl-1,3-thiazol-5-yl]butan-2-one.
| Compound Name | 4-[2-(2-bromophenyl)-4-methyl-1,3-thiazol-5-yl]butan-2-one |
|---|---|
| PubChem CID | 116886477 |
| Molecular Formula | C14H14BrNOS |
| Molecular Weight | 324.24 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 4-[2-(2-bromophenyl)-4-methyl-1,3-thiazol-5-yl]butan-2-one |
| SMILES | CC(=O)CCc1sc(-c2ccccc2Br)nc1C |
| InChI | InChI=1S/C14H14BrNOS/c1-9(17)7-8-13-10(2)16-14(18-13)11-5-3-4-6-12(11)15/h3-6H,7-8H2,1-2H3 |
| InChIKey | VGJKUEYVJWFLEQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.24 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |