About [1-(4-methyl-2-propyl-1,3-thiazol-5-yl)cyclopropyl]methanol
[1-(4-methyl-2-propyl-1,3-thiazol-5-yl)cyclopropyl]methanol (PubChem CID 116886853) has the molecular formula C11H17NOS
and a molecular weight of 211.33 g/mol. Its IUPAC name is [1-(4-methyl-2-propyl-1,3-thiazol-5-yl)cyclopropyl]methanol.
Molecular Properties
| Compound Name | [1-(4-methyl-2-propyl-1,3-thiazol-5-yl)cyclopropyl]methanol |
| PubChem CID | 116886853 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | [1-(4-methyl-2-propyl-1,3-thiazol-5-yl)cyclopropyl]methanol |
| SMILES | CCCc1nc(C)c(C2(CO)CC2)s1 |
| InChI | InChI=1S/C11H17NOS/c1-3-4-9-12-8(2)10(14-9)11(7-13)5-6-11/h13H,3-7H2,1-2H3 |
| InChIKey | NGHUIAWFULCBCX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(4-methyl-2-propyl-1,3-thiazol-5-yl)cyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-methyl-2-propyl-1,3-thiazol-5-yl)cyclopropyl]methanol?
The IUPAC name of [1-(4-methyl-2-propyl-1,3-thiazol-5-yl)cyclopropyl]methanol (CID 116886853) is [1-(4-methyl-2-propyl-1,3-thiazol-5-yl)cyclopropyl]methanol.
What is the SMILES notation for [1-(4-methyl-2-propyl-1,3-thiazol-5-yl)cyclopropyl]methanol?
The canonical SMILES for [1-(4-methyl-2-propyl-1,3-thiazol-5-yl)cyclopropyl]methanol is CCCc1nc(C)c(C2(CO)CC2)s1.
What is the InChIKey of [1-(4-methyl-2-propyl-1,3-thiazol-5-yl)cyclopropyl]methanol?
The InChIKey is NGHUIAWFULCBCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NOS/c1-3-4-9-12-8(2)10(14-9)11(7-13)5-6-11/h13H,3-7H2,1-2H3.
What are the key properties of [1-(4-methyl-2-propyl-1,3-thiazol-5-yl)cyclopropyl]methanol?
[1-(4-methyl-2-propyl-1,3-thiazol-5-yl)cyclopropyl]methanol has a molecular weight of 211.33 g/mol, XLogP of 2.43, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-methyl-2-propyl-1,3-thiazol-5-yl)cyclopropyl]methanol is sourced from PubChem (CID 116886853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).