C19H22N2O2S — CID 11688736
N'-[[6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]ethanimidamide (PubChem CID 11688736) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is N'-[[6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]ethanimidamide.
| Compound Name | N'-[[6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]ethanimidamide |
|---|---|
| PubChem CID | 11688736 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N'-[[6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]ethanimidamide |
| SMILES | C/C(N)=N\CC1CCCc2cc(S(=O)(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C19H22N2O2S/c1-14(20)21-13-16-7-5-6-15-12-18(10-11-19(15)16)24(22,23)17-8-3-2-4-9-17/h2-4,8-12,16H,5-7,13H2,1H3,(H2,20,21) |
| InChIKey | PXCOASFULUFKCU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|