C13H22N2S — CID 116888466
3-(2-cyclopentyl-1,3-thiazol-4-yl)-3-methylbutan-1-amine (PubChem CID 116888466) has the molecular formula C13H22N2S and a molecular weight of 238.40 g/mol. Its IUPAC name is 3-(2-cyclopentyl-1,3-thiazol-4-yl)-3-methylbutan-1-amine.
| Compound Name | 3-(2-cyclopentyl-1,3-thiazol-4-yl)-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 116888466 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 3-(2-cyclopentyl-1,3-thiazol-4-yl)-3-methylbutan-1-amine |
| SMILES | CC(C)(CCN)c1csc(C2CCCC2)n1 |
| InChI | InChI=1S/C13H22N2S/c1-13(2,7-8-14)11-9-16-12(15-11)10-5-3-4-6-10/h9-10H,3-8,14H2,1-2H3 |
| InChIKey | XBICYVBFXHSGGU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |