C16H16N2S — CID 116889911
2-(4-cyclohexylphenyl)-1,3-thiazole-4-carbonitrile (PubChem CID 116889911) has the molecular formula C16H16N2S and a molecular weight of 268.38 g/mol. Its IUPAC name is 2-(4-cyclohexylphenyl)-1,3-thiazole-4-carbonitrile.
| Compound Name | 2-(4-cyclohexylphenyl)-1,3-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 116889911 |
| Molecular Formula | C16H16N2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-(4-cyclohexylphenyl)-1,3-thiazole-4-carbonitrile |
| SMILES | N#Cc1csc(-c2ccc(C3CCCCC3)cc2)n1 |
| InChI | InChI=1S/C16H16N2S/c17-10-15-11-19-16(18-15)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h6-9,11-12H,1-5H2 |
| InChIKey | KYUMDLXPJPLKDS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |