About 2-[2-(3,4-dimethylphenyl)-1,3-thiazol-4-yl]acetonitrile
2-[2-(3,4-dimethylphenyl)-1,3-thiazol-4-yl]acetonitrile (PubChem CID 116889988) has the molecular formula C13H12N2S
and a molecular weight of 228.32 g/mol. Its IUPAC name is 2-[2-(3,4-dimethylphenyl)-1,3-thiazol-4-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[2-(3,4-dimethylphenyl)-1,3-thiazol-4-yl]acetonitrile |
| PubChem CID | 116889988 |
| Molecular Formula | C13H12N2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 2-[2-(3,4-dimethylphenyl)-1,3-thiazol-4-yl]acetonitrile |
| SMILES | Cc1ccc(-c2nc(CC#N)cs2)cc1C |
| InChI | InChI=1S/C13H12N2S/c1-9-3-4-11(7-10(9)2)13-15-12(5-6-14)8-16-13/h3-4,7-8H,5H2,1-2H3 |
| InChIKey | MEDNFPGXBPKZAA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(3,4-dimethylphenyl)-1,3-thiazol-4-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,4-dimethylphenyl)-1,3-thiazol-4-yl]acetonitrile?
The IUPAC name of 2-[2-(3,4-dimethylphenyl)-1,3-thiazol-4-yl]acetonitrile (CID 116889988) is 2-[2-(3,4-dimethylphenyl)-1,3-thiazol-4-yl]acetonitrile.
What is the SMILES notation for 2-[2-(3,4-dimethylphenyl)-1,3-thiazol-4-yl]acetonitrile?
The canonical SMILES for 2-[2-(3,4-dimethylphenyl)-1,3-thiazol-4-yl]acetonitrile is Cc1ccc(-c2nc(CC#N)cs2)cc1C.
What is the InChIKey of 2-[2-(3,4-dimethylphenyl)-1,3-thiazol-4-yl]acetonitrile?
The InChIKey is MEDNFPGXBPKZAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2S/c1-9-3-4-11(7-10(9)2)13-15-12(5-6-14)8-16-13/h3-4,7-8H,5H2,1-2H3.
What are the key properties of 2-[2-(3,4-dimethylphenyl)-1,3-thiazol-4-yl]acetonitrile?
2-[2-(3,4-dimethylphenyl)-1,3-thiazol-4-yl]acetonitrile has a molecular weight of 228.32 g/mol, XLogP of 3.49, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,4-dimethylphenyl)-1,3-thiazol-4-yl]acetonitrile is sourced from PubChem (CID 116889988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).