About [3-(2-methyl-1,3-thiazol-4-yl)oxetan-3-yl]methanamine
[3-(2-methyl-1,3-thiazol-4-yl)oxetan-3-yl]methanamine (PubChem CID 116891202) has the molecular formula C8H12N2OS
and a molecular weight of 184.26 g/mol. Its IUPAC name is [3-(2-methyl-1,3-thiazol-4-yl)oxetan-3-yl]methanamine.
Analyze [3-(2-methyl-1,3-thiazol-4-yl)oxetan-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-methyl-1,3-thiazol-4-yl)oxetan-3-yl]methanamine?
The IUPAC name of [3-(2-methyl-1,3-thiazol-4-yl)oxetan-3-yl]methanamine (CID 116891202) is [3-(2-methyl-1,3-thiazol-4-yl)oxetan-3-yl]methanamine.
What is the SMILES notation for [3-(2-methyl-1,3-thiazol-4-yl)oxetan-3-yl]methanamine?
The canonical SMILES for [3-(2-methyl-1,3-thiazol-4-yl)oxetan-3-yl]methanamine is Cc1nc(C2(CN)COC2)cs1.
What is the InChIKey of [3-(2-methyl-1,3-thiazol-4-yl)oxetan-3-yl]methanamine?
The InChIKey is KVLCDKDZAUBCCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2OS/c1-6-10-7(2-12-6)8(3-9)4-11-5-8/h2H,3-5,9H2,1H3.
What are the key properties of [3-(2-methyl-1,3-thiazol-4-yl)oxetan-3-yl]methanamine?
[3-(2-methyl-1,3-thiazol-4-yl)oxetan-3-yl]methanamine has a molecular weight of 184.26 g/mol, XLogP of 0.68, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-methyl-1,3-thiazol-4-yl)oxetan-3-yl]methanamine is sourced from PubChem (CID 116891202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).