About methyl 2-(2-cyclopentyl-1,3-thiazol-4-yl)butanoate
methyl 2-(2-cyclopentyl-1,3-thiazol-4-yl)butanoate (PubChem CID 116891448) has the molecular formula C13H19NO2S
and a molecular weight of 253.37 g/mol. Its IUPAC name is methyl 2-(2-cyclopentyl-1,3-thiazol-4-yl)butanoate.
Molecular Properties
| Compound Name | methyl 2-(2-cyclopentyl-1,3-thiazol-4-yl)butanoate |
| PubChem CID | 116891448 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | methyl 2-(2-cyclopentyl-1,3-thiazol-4-yl)butanoate |
| SMILES | CCC(C(=O)OC)c1csc(C2CCCC2)n1 |
| InChI | InChI=1S/C13H19NO2S/c1-3-10(13(15)16-2)11-8-17-12(14-11)9-6-4-5-7-9/h8-10H,3-7H2,1-2H3 |
| InChIKey | GNEYLZXIEUQEPA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(2-cyclopentyl-1,3-thiazol-4-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2-cyclopentyl-1,3-thiazol-4-yl)butanoate?
The IUPAC name of methyl 2-(2-cyclopentyl-1,3-thiazol-4-yl)butanoate (CID 116891448) is methyl 2-(2-cyclopentyl-1,3-thiazol-4-yl)butanoate.
What is the SMILES notation for methyl 2-(2-cyclopentyl-1,3-thiazol-4-yl)butanoate?
The canonical SMILES for methyl 2-(2-cyclopentyl-1,3-thiazol-4-yl)butanoate is CCC(C(=O)OC)c1csc(C2CCCC2)n1.
What is the InChIKey of methyl 2-(2-cyclopentyl-1,3-thiazol-4-yl)butanoate?
The InChIKey is GNEYLZXIEUQEPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2S/c1-3-10(13(15)16-2)11-8-17-12(14-11)9-6-4-5-7-9/h8-10H,3-7H2,1-2H3.
What are the key properties of methyl 2-(2-cyclopentyl-1,3-thiazol-4-yl)butanoate?
methyl 2-(2-cyclopentyl-1,3-thiazol-4-yl)butanoate has a molecular weight of 253.37 g/mol, XLogP of 3.47, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-cyclopentyl-1,3-thiazol-4-yl)butanoate is sourced from PubChem (CID 116891448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).