C20H21N3O4 — CID 11689170
3-[4-[2-[(2-oxo-3H-1,3-benzoxazol-7-yl)oxy]ethylamino]butoxy]benzonitrile (PubChem CID 11689170) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 3-[4-[2-[(2-oxo-3H-1,3-benzoxazol-7-yl)oxy]ethylamino]butoxy]benzonitrile.
| Compound Name | 3-[4-[2-[(2-oxo-3H-1,3-benzoxazol-7-yl)oxy]ethylamino]butoxy]benzonitrile |
|---|---|
| PubChem CID | 11689170 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 3-[4-[2-[(2-oxo-3H-1,3-benzoxazol-7-yl)oxy]ethylamino]butoxy]benzonitrile |
| SMILES | N#Cc1cccc(OCCCCNCCOc2cccc3[nH]c(=O)oc23)c1 |
| InChI | InChI=1S/C20H21N3O4/c21-14-15-5-3-6-16(13-15)25-11-2-1-9-22-10-12-26-18-8-4-7-17-19(18)27-20(24)23-17/h3-8,13,22H,1-2,9-12H2,(H,23,24) |
| InChIKey | BPGYLCZBMIFWJY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|